CAS 447433-84-3 is the registry number for 3-Amino-2,4,5,6-tetrachloropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,4,5,6-tetrachloropyridin-3-amine (CAS 447433-84-3) is a chemical compound with the molecular formula C5H2Cl4N2 and a molecular weight of 231.9 g/mol. IUPAC name: 2,4,5,6-tetrachloropyridin-3-amine. InChIKey: NIJKPRQUINCPAX-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl4N2 |
|---|---|
| Molecular weight | 231.9 g/mol |
| IUPAC name | 2,4,5,6-tetrachloropyridin-3-amine |
| InChIKey | NIJKPRQUINCPAX-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(N=C1Cl)Cl)Cl)Cl)N |
Computed by PubChem (NCBI)