2,3,6-Trifluorobenzoic acid 98%
cas: 2358-29-4 — see every product listed under this CAS number, including other names
2,3,6-Trifluorobenzoic acid 98% (CAS 2358-29-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130985-1g |
| cas | 2358-29-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 370.38 Pln | |
| Ambeed | 100g | 1260.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A130985 |
2,3,6-trifluorobenzoic acid (CAS 2358-29-4) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,3,6-trifluorobenzoic acid. InChIKey: MGUPHQGQNHDGNK-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,3,6-trifluorobenzoic acid |
| InChIKey | MGUPHQGQNHDGNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)F)F |
Computed by PubChem (NCBI)