CAS 121602-93-5 appears in our catalog under these names: 3,4,5-Trifluoro Benzoic Acid, 3,4,5–Trifluorobenzoic Acid, 3,4,5-Trifluorobenzoic acid, 3,4,5-Trifluorobenzoic Acid, >98.0%(T)(GC), 3,4,5-Trifluorobenzoic acid 98%. Offered by: Chemat Brand, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: on request, 100g, 500g, 250g, 1g, 5g, 10g, 25g.
3,4,5-trifluorobenzoic acid (CAS 121602-93-5) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 3,4,5-trifluorobenzoic acid. InChIKey: VJMYKESYFHYUEQ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 3,4,5-trifluorobenzoic acid |
| InChIKey | VJMYKESYFHYUEQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(=O)O |
Computed by PubChem (NCBI)