CAS 2358-29-4 appears in our catalog under these names: 2,3,6-Trifluorobenzoic acid, 97%, 2,3,6-Trifluoro Benzoic Acid, 2,3,6–Trifluorobenzoic acid, 2,3,6-Trifluorobenzoic Acid, >98.0%(GC)(T), 2,3,6-Trifluorobenzoic acid 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g, on request, 10g.
2,3,6-trifluorobenzoic acid (CAS 2358-29-4) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,3,6-trifluorobenzoic acid. InChIKey: MGUPHQGQNHDGNK-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,3,6-trifluorobenzoic acid |
| InChIKey | MGUPHQGQNHDGNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)F)F |
Computed by PubChem (NCBI)