CAS 654-87-5 appears in our catalog under these names: 2,3,5-Trifluorobenzoic acid, 98%, 2,3,5–Trifluorobenzoic Acid, 2,3,5-Trifluorobenzoic Acid, >98.0%(GC)(T), 2,3,5-Trifluorobenzoic acid 98%, 2,3,5-Trifluorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 250mg, 10g.
2,3,5-trifluorobenzoic acid (CAS 654-87-5) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,3,5-trifluorobenzoic acid. InChIKey: CPZROMDDCPPFOO-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,3,5-trifluorobenzoic acid |
| InChIKey | CPZROMDDCPPFOO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)F)F |
Computed by PubChem (NCBI)