cas: 20880-92-6 — see every product listed under this CAS number, including other names
2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose, 98%, 98% (CAS 20880-92-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JWI-5g |
| cas | 20880-92-6 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 155.60 Pln | |
| Chemat | 500g | 595.20 Pln | |
| Chemat | 1kg | 971.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol (CAS 20880-92-6) is a chemical compound with the molecular formula C12H20O6 and a molecular weight of 260.28 g/mol. IUPAC name: [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol. InChIKey: PSSHGMIAIUYOJF-XBWDGYHZSA-N.
| Molecular formula | C12H20O6 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol |
| InChIKey | PSSHGMIAIUYOJF-XBWDGYHZSA-N |
| SMILES | CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)CO)C |
Computed by PubChem (NCBI)