cas: 20880-92-6 — see every product listed under this CAS number, including other names
2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose (CAS 20880-92-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM60330C-10g |
| cas | 20880-92-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1182.47 Pln | |
| Chemat | 25g | 1627.78 Pln | |
| Chemat | 50g | 2319.52 Pln | |
| Chemat | 5g | 935.12 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol (CAS 20880-92-6) is a chemical compound with the molecular formula C12H20O6 and a molecular weight of 260.28 g/mol. IUPAC name: [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol. InChIKey: PSSHGMIAIUYOJF-XBWDGYHZSA-N.
| Molecular formula | C12H20O6 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol |
| InChIKey | PSSHGMIAIUYOJF-XBWDGYHZSA-N |
| SMILES | CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)CO)C |
Computed by PubChem (NCBI)