cas: 20880-92-6 — see every product listed under this CAS number, including other names
Diacetone-β-D-fructose 97% (CAS 20880-92-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148534-5g |
| cas | 20880-92-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 292.50 Pln | |
| Ambeed | 500g | 882.12 Pln | |
| Ambeed | 1000g | 1455.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148534 |
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol (CAS 20880-92-6) is a chemical compound with the molecular formula C12H20O6 and a molecular weight of 260.28 g/mol. IUPAC name: [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol. InChIKey: PSSHGMIAIUYOJF-XBWDGYHZSA-N.
| Molecular formula | C12H20O6 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol |
| InChIKey | PSSHGMIAIUYOJF-XBWDGYHZSA-N |
| SMILES | CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)CO)C |
Computed by PubChem (NCBI)