cas: 721968-63-4 — see every product listed under this CAS number, including other names
2,3-DIHYDRO-1H-INDEN-5-YLMETHANAMINE HCL, 98% (CAS 721968-63-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F527353-50MG |
| cas | 721968-63-4 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 643.54 Pln | |
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 250mg | 1080.89 Pln | |
| Fluorochem | 500mg | 1945.17 Pln | |
| Fluorochem | 1g | 2195.08 Pln | |
| Fluorochem | 2.5g | 5350.22 Pln | |
| Fluorochem | 5g | 9234.27 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2,3-dihydro-1H-inden-5-ylmethanamine;hydrochloride (CAS 721968-63-4) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: 2,3-dihydro-1H-inden-5-ylmethanamine;hydrochloride. InChIKey: DQRLVXOHCPCRMW-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | 2,3-dihydro-1H-inden-5-ylmethanamine;hydrochloride |
| InChIKey | DQRLVXOHCPCRMW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)