CAS 721968-63-4 appears in our catalog under these names: 2,3-Dihydro-1h-inden-5-ylmethanamine hydrochloride, 95%, (2,3-Dihydro-1H-inden-5-yl)methanamine hydrochloride, 98%, (2,3–Dihydro–1H–inden–5–yl)methanamine hydrochloride, 2,3-Dihydro-1H-Inden-5-Ylmethanamine Hydrochloride, (2,3-Dihydro-1H-inden-5-yl)methanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg, 500mg, 2.5g.
2,3-dihydro-1H-inden-5-ylmethanamine;hydrochloride (CAS 721968-63-4) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: 2,3-dihydro-1H-inden-5-ylmethanamine;hydrochloride. InChIKey: DQRLVXOHCPCRMW-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | 2,3-dihydro-1H-inden-5-ylmethanamine;hydrochloride |
| InChIKey | DQRLVXOHCPCRMW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)