2,3-Dichloro-4-(methylsulfonyl)benzoic acid, 97%
cas: 105917-77-9 — see every product listed under this CAS number, including other names
2,3-Dichloro-4-(methylsulfonyl)benzoic acid, 97% (CAS 105917-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A473917-100mg |
| cas | 105917-77-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 737.50 Pln | |
| Ambeed | 1g | 1783.25 Pln | |
| Ambeed | 5g | 6049.69 Pln | |
| BLDpharm | 100mg | 508.73 Pln | |
| BLDpharm | 250mg | 775.31 Pln | |
| BLDpharm | 1g | 1908.24 Pln | |
| BLDpharm | 5g | 6512.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,3-dichloro-4-methylsulfonylbenzoic acid (CAS 105917-77-9) is a chemical compound with the molecular formula C8H6Cl2O4S and a molecular weight of 269.10 g/mol. IUPAC name: 2,3-dichloro-4-methylsulfonylbenzoic acid. InChIKey: OGKHGNNGBKDXOK-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O4S |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | 2,3-dichloro-4-methylsulfonylbenzoic acid |
| InChIKey | OGKHGNNGBKDXOK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C(=C(C=C1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)