Products 1121585-09-8
CAS 1121585-09-8 appears in our catalog under these names: 2,6-Dichloro-4-Methylsulfonylbenzoic Acid, 2,6-Dichloro-4-(methylsulfonyl)benzoic acid, 97%, 2,6-Dichloro-4-methanesulfonylbenzoic acid, 2,6-Dichloro-4-(methylsulfonyl)benzoic acid, 95%, 95%. Offered by: Chemat Brand, AmBeed, Biosynth, Chemat. Available pack sizes: on request, 1g, 50mg, 0,5g, 100mg.
2,6-dichloro-4-methylsulfonylbenzoic acid (CAS 1121585-09-8) is a chemical compound with the molecular formula C8H6Cl2O4S and a molecular weight of 269.10 g/mol. IUPAC name: 2,6-dichloro-4-methylsulfonylbenzoic acid. InChIKey: NHCGKUSJQYWQCS-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O4S |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | 2,6-dichloro-4-methylsulfonylbenzoic acid |
| InChIKey | NHCGKUSJQYWQCS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C(=C1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)