Products 105917-77-9
CAS 105917-77-9 appears in our catalog under these names: 2,3-dichloro-4-methylsulfonylbenzoic acid, 2,3-Dichloro-4-(methylsulfonyl)benzoic acid, 97%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
2,3-dichloro-4-methylsulfonylbenzoic acid (CAS 105917-77-9) is a chemical compound with the molecular formula C8H6Cl2O4S and a molecular weight of 269.10 g/mol. IUPAC name: 2,3-dichloro-4-methylsulfonylbenzoic acid. InChIKey: OGKHGNNGBKDXOK-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O4S |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | 2,3-dichloro-4-methylsulfonylbenzoic acid |
| InChIKey | OGKHGNNGBKDXOK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C(=C(C=C1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)