2,3-Dichloro-6-(trifluoromethyl)quinoxaline, 95+%
cas: 55686-95-8 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-(trifluoromethyl)quinoxaline, 95+% (CAS 55686-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A902095-100mg |
| cas | 55686-95-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 720.81 Pln | |
| Ambeed | 250mg | 1238.12 Pln | |
| Ambeed | 1g | 3223.94 Pln | |
| Chemat | 100mg | 746.00 Pln | |
| Chemat | 250mg | 1288.40 Pln | |
| Chemat | 1g | 3376.40 Pln | |
| BLDpharm | 100mg | 769.75 Pln | |
| BLDpharm | 250mg | 1330.67 Pln | |
| BLDpharm | 1g | 3468.80 Pln | |
| Fluorochem | 100mg | 1382.86 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
2,3-dichloro-6-(trifluoromethyl)quinoxaline (CAS 55686-95-8) is a chemical compound with the molecular formula C9H3Cl2F3N2 and a molecular weight of 267.03 g/mol. IUPAC name: 2,3-dichloro-6-(trifluoromethyl)quinoxaline. InChIKey: JJTQVWHSMBWEJX-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F3N2 |
|---|---|
| Molecular weight | 267.03 g/mol |
| IUPAC name | 2,3-dichloro-6-(trifluoromethyl)quinoxaline |
| InChIKey | JJTQVWHSMBWEJX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)