Products 864291-30-5
CAS 864291-30-5 appears in our catalog under these names: 2,4-Dichloro-6-(trifluoromethyl)quinazoline, 97%, 2,4-Dichloro-6-(trifluoromethyl)quinazoline, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
2,4-dichloro-6-(trifluoromethyl)quinazoline (CAS 864291-30-5) is a chemical compound with the molecular formula C9H3Cl2F3N2 and a molecular weight of 267.03 g/mol. IUPAC name: 2,4-dichloro-6-(trifluoromethyl)quinazoline. InChIKey: LHVPNHJCJOCBIS-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F3N2 |
|---|---|
| Molecular weight | 267.03 g/mol |
| IUPAC name | 2,4-dichloro-6-(trifluoromethyl)quinazoline |
| InChIKey | LHVPNHJCJOCBIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)