Products 55686-95-8
CAS 55686-95-8 appears in our catalog under these names: 2,3-Dichloro-6-(trifluoromethyl)quinoxaline, 95+%, 95+%, 2,3-Dichloro-6-(trifluoromethyl)quinoxaline, 95+%, 2,3-Dichloro-6-(Trifluoromethyl) Quinoxaline, 2,3-Dichloro-6-(trifluoromethyl)quinoxaline. Offered by: Chemat, Fluorochem, Ambeed, Chemat Brand, TRC. Available pack sizes: 100mg, 250mg, 1g, on request, 500mg, 0,1g, 0,05g, 0,25g.
2,3-dichloro-6-(trifluoromethyl)quinoxaline (CAS 55686-95-8) is a chemical compound with the molecular formula C9H3Cl2F3N2 and a molecular weight of 267.03 g/mol. IUPAC name: 2,3-dichloro-6-(trifluoromethyl)quinoxaline. InChIKey: JJTQVWHSMBWEJX-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F3N2 |
|---|---|
| Molecular weight | 267.03 g/mol |
| IUPAC name | 2,3-dichloro-6-(trifluoromethyl)quinoxaline |
| InChIKey | JJTQVWHSMBWEJX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)