CAS 2489629-32-3 is the registry number for 6,8-Dichloro-3-(trifluoromethyl)-1,7-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-3-(trifluoromethyl)-1,7-naphthyridine (CAS 2489629-32-3) is a chemical compound with the molecular formula C9H3Cl2F3N2 and a molecular weight of 267.03 g/mol. IUPAC name: 6,8-dichloro-3-(trifluoromethyl)-1,7-naphthyridine. InChIKey: IBBSKPMCOJMYPU-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F3N2 |
|---|---|
| Molecular weight | 267.03 g/mol |
| IUPAC name | 6,8-dichloro-3-(trifluoromethyl)-1,7-naphthyridine |
| InChIKey | IBBSKPMCOJMYPU-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(N=C(C2=NC=C1C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)