cas: 6590-97-2 — see every product listed under this CAS number, including other names
2,3-Dichlorophenyl Isothiocyanate, >98.0%(GC) (CAS 6590-97-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D4923-5G |
| cas | 6590-97-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 267.35 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1,2-dichloro-3-isothiocyanatobenzene (CAS 6590-97-2) is a chemical compound with the molecular formula C7H3Cl2NS and a molecular weight of 204.08 g/mol. IUPAC name: 1,2-dichloro-3-isothiocyanatobenzene. InChIKey: RQZIODPVCCTBAQ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NS |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 1,2-dichloro-3-isothiocyanatobenzene |
| InChIKey | RQZIODPVCCTBAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)N=C=S |
Computed by PubChem (NCBI)