cas: 6590-97-2 — see every product listed under this CAS number, including other names
2,3-Dichlorophenylisothiocyanate, 97%, 97% (CAS 6590-97-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FHQ-1g |
| cas | 6590-97-2 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 275.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,2-dichloro-3-isothiocyanatobenzene (CAS 6590-97-2) is a chemical compound with the molecular formula C7H3Cl2NS and a molecular weight of 204.08 g/mol. IUPAC name: 1,2-dichloro-3-isothiocyanatobenzene. InChIKey: RQZIODPVCCTBAQ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NS |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 1,2-dichloro-3-isothiocyanatobenzene |
| InChIKey | RQZIODPVCCTBAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)N=C=S |
Computed by PubChem (NCBI)