cas: 151169-74-3 — see every product listed under this CAS number, including other names
2,3-Dichlorophenylboronic Acid (contains varying amounts of Anhydride) (CAS 151169-74-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3434-5G |
| cas | 151169-74-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 167.52 Pln | |
| TCI | 25g | 516.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(2,3-dichlorophenyl)boronic acid (CAS 151169-74-3) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (2,3-dichlorophenyl)boronic acid. InChIKey: TYIKXPOMOYDGCS-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (2,3-dichlorophenyl)boronic acid |
| InChIKey | TYIKXPOMOYDGCS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)