2,3-Dichlorophenylboronic acid, 98%, 98%
cas: 151169-74-3 — see every product listed under this CAS number, including other names
2,3-Dichlorophenylboronic acid, 98%, 98% (CAS 151169-74-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112N65-1g |
| cas | 151169-74-3 |
| size | 1g |
| availability | 3000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 500g | 1670.40 Pln | |
| Chemat | 1kg | 2646.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,3-dichlorophenyl)boronic acid (CAS 151169-74-3) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (2,3-dichlorophenyl)boronic acid. InChIKey: TYIKXPOMOYDGCS-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (2,3-dichlorophenyl)boronic acid |
| InChIKey | TYIKXPOMOYDGCS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,3-dichlorophenyl)boronic Acid, 2,3-Dichlorobenzeneboronic Acid, 2,3-Dichlorophenylboronic acid, Boronic acid, B-(2,3-dichlorophenyl)-, Boronic acid, (2,3-dichlorophenyl)-, 2,3-Dichlorophenylboronicacid, 2,3-dichlorophenyl boronic acid, dichlorophenylboronic acid, dichlorobenzene boronic acid, orb2940168