cas: 151169-74-3 — see every product listed under this CAS number, including other names
2,3-Dichlorophenylboronic acid 98% (CAS 151169-74-3) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A329444-1000g |
| cas | 151169-74-3 |
| size | 1000g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2745.56 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 192.38 Pln | |
| Ambeed | 100g | 520.56 Pln | |
| Ambeed | 500g | 1738.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A329444 |
(2,3-dichlorophenyl)boronic acid (CAS 151169-74-3) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (2,3-dichlorophenyl)boronic acid. InChIKey: TYIKXPOMOYDGCS-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (2,3-dichlorophenyl)boronic acid |
| InChIKey | TYIKXPOMOYDGCS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)