cas: 126714-85-0 — see every product listed under this CAS number, including other names
2,3-Dichlorothiophene-5-sulfonyl chloride (CAS 126714-85-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032694-1G |
| cas | 126714-85-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1820.21 Pln |
| delivery time | 2-3 weeks |
|---|
4,5-dichlorothiophene-2-sulfonyl chloride (CAS 126714-85-0) is a chemical compound with the molecular formula C4HCl3O2S2 and a molecular weight of 251.5 g/mol. IUPAC name: 4,5-dichlorothiophene-2-sulfonyl chloride. InChIKey: IVTWLTRKVRJPNG-UHFFFAOYSA-N.
| Molecular formula | C4HCl3O2S2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | 4,5-dichlorothiophene-2-sulfonyl chloride |
| InChIKey | IVTWLTRKVRJPNG-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)