cas: 84594-78-5 — see every product listed under this CAS number, including other names
2,3-Dihydro-6-nitro-5-benzofuranamine, 98%, 98% (CAS 84594-78-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GAGO-250mg |
| cas | 84594-78-5 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 424.40 Pln | |
| Chemat | 25g | 875.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-nitro-2,3-dihydro-1-benzofuran-5-amine (CAS 84594-78-5) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 6-nitro-2,3-dihydro-1-benzofuran-5-amine. InChIKey: BTYCNIIIWYDUOF-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 6-nitro-2,3-dihydro-1-benzofuran-5-amine |
| InChIKey | BTYCNIIIWYDUOF-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C21)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)