cas: 84594-78-5 — see every product listed under this CAS number, including other names
6-NITRO-2,3-DIHYDROBENZOFURAN-5-AMINE, 97% (CAS 84594-78-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F506167-1G |
| cas | 84594-78-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 10g | 518.59 Pln | |
| Fluorochem | 25g | 1205.84 Pln | |
| Fluorochem | 100g | 4662.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-nitro-2,3-dihydro-1-benzofuran-5-amine (CAS 84594-78-5) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 6-nitro-2,3-dihydro-1-benzofuran-5-amine. InChIKey: BTYCNIIIWYDUOF-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 6-nitro-2,3-dihydro-1-benzofuran-5-amine |
| InChIKey | BTYCNIIIWYDUOF-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C21)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)