cas: 55745-71-6 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzo[b]furan-5-carbonyl chloride, 98% (CAS 55745-71-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017489-250MG |
| cas | 55745-71-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 778.91 Pln | |
| Fluorochem | 1g | 1825.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,3-dihydro-1-benzofuran-5-carbonyl chloride (CAS 55745-71-6) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-5-carbonyl chloride. InChIKey: YQCKMNRXXRJGIZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 2,3-dihydro-1-benzofuran-5-carbonyl chloride |
| InChIKey | YQCKMNRXXRJGIZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)