CAS 1199782-69-8 is the registry number for 7-Chloro-5-hydroxy-1-indanone, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-5-hydroxy-2,3-dihydroinden-1-one (CAS 1199782-69-8) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 7-chloro-5-hydroxy-2,3-dihydroinden-1-one. InChIKey: KDRCVDSYTJRFMF-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 7-chloro-5-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | KDRCVDSYTJRFMF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2Cl)O |
Computed by PubChem (NCBI)