CAS 55745-71-6 is the registry number for 2,3-Dihydro-1-benzofuran-5-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2,3-dihydro-1-benzofuran-5-carbonyl chloride (CAS 55745-71-6) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-5-carbonyl chloride. InChIKey: YQCKMNRXXRJGIZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 2,3-dihydro-1-benzofuran-5-carbonyl chloride |
| InChIKey | YQCKMNRXXRJGIZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)