Products 55745-71-6

CAS 55745-71-6 appears in our catalog under these names: 2,3-Dihydro-1-benzofuran-5-carbonyl chloride, 95%, 2,3-Dihydrobenzo[b]furan-5-carbonyl chloride, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,3-dihydro-1-benzofuran-5-carbonyl chloride (CAS 55745-71-6) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-5-carbonyl chloride. InChIKey: YQCKMNRXXRJGIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClO2
Molecular weight182.60 g/mol
IUPAC name2,3-dihydro-1-benzofuran-5-carbonyl chloride
InChIKeyYQCKMNRXXRJGIZ-UHFFFAOYSA-N
SMILESC1COC2=C1C=C(C=C2)C(=O)Cl

Computed by PubChem (NCBI)