Products 4377-63-3
CAS 4377-63-3 appears in our catalog under these names: 6-Chloro-chroman-2-one, 96%, 6-Chlorochroman-2-one 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 25g, 1g, 5g, 100g, 100mg, 250mg.
6-chloro-3,4-dihydrochromen-2-one (CAS 4377-63-3) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 6-chloro-3,4-dihydrochromen-2-one. InChIKey: KKMNLXQACWRZHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 6-chloro-3,4-dihydrochromen-2-one |
| InChIKey | KKMNLXQACWRZHQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
6-Chloro-chroman-2-one, 6-Chloro-2-chromanone, 6-Chlorochroman-2-one, 6-chlorochromanone, 6-chloro-3,4-dihydrochromen-2-one, 6-Chloro-3,4-dihydro-2H-1-benzopyran-2-one, 2H-1-Benzopyran-2-one, 6-chloro-3,4-dihydro, 6-Chloro-3,4-dihydrocoumarin, 2H-1-Benzopyran-2-one, 6-chloro-3,4-dihydro-, 6-Chloro-2-chromanone #