2,3-Dimethoxybenzeneboronic acid, 98%
cas: 40972-86-9 — see every product listed under this CAS number, including other names
2,3-Dimethoxybenzeneboronic acid, 98% (CAS 40972-86-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A247558-1g |
| cas | 40972-86-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 181.25 Pln | |
| Ambeed | 100g | 459.38 Pln | |
| Ambeed | 500g | 2022.44 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 352.40 Pln | |
| Chemat | 500g | 1560.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 158.86 Pln | |
| BLDpharm | 25g | 192.18 Pln | |
| BLDpharm | 100g | 492.07 Pln | |
| BLDpharm | 500g | 2174.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2,3-dimethoxyphenyl)boronic acid (CAS 40972-86-9) is a chemical compound with the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. IUPAC name: (2,3-dimethoxyphenyl)boronic acid. InChIKey: VREWSCMOGIXMDQ-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4 |
|---|---|
| Molecular weight | 181.98 g/mol |
| IUPAC name | (2,3-dimethoxyphenyl)boronic acid |
| InChIKey | VREWSCMOGIXMDQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3-Dimethoxybenzeneboronic Acid, 2,3-Dimethoxyphenylboronic acid, (2,3-dimethoxyphenyl)boronic Acid, Boronic acid, (2,3-dimethoxyphenyl)-, 2,3-dimethoxyphenyl boronic acid, 2,3-Dimethoxyphenylboronic acid, 97%, 2,3-DimethoxybenzeneboronicAcid, 2,3-dimethoxy-phenylboronic acid, 2,3-dimethoxybenzene boronic acid, (2,3-Dimethoxybenzeneboronic acid