CAS 908142-03-0 appears in our catalog under these names: 3-Hydroxymethyl-4-methoxyphenylboronic acid, 97%, (3–(Hydroxymethyl)–4–Methoxyphenyl)Boronic Acid, 3-(Hydroxymethyl)-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride), (3-(Hydroxymethyl)-4-methoxyphenyl)boronic acid 97%, Boronic acid, B-[3-(hydroxymethyl)-4-methoxyphenyl]-, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 1g, 100g, 25g, 5g, 2,5g, 10g.
[3-(hydroxymethyl)-4-methoxyphenyl]boronic acid (CAS 908142-03-0) is a chemical compound with the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. IUPAC name: [3-(hydroxymethyl)-4-methoxyphenyl]boronic acid. InChIKey: DOQUCBSZQOPLGT-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4 |
|---|---|
| Molecular weight | 181.98 g/mol |
| IUPAC name | [3-(hydroxymethyl)-4-methoxyphenyl]boronic acid |
| InChIKey | DOQUCBSZQOPLGT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)CO)(O)O |
Computed by PubChem (NCBI)