Products 40972-86-9
CAS 40972-86-9 appears in our catalog under these names: 2,3–Dimethoxybenzeneboronic Acid (contains varying amounts of Anhydride), 2,3-Dimethoxyphenylboronic acid/ 95+%, 2,3-Dimethoxybenzeneboronic acid, 97+% , 2,3-Dimethoxyphenylboronic acid, 2,3-Dimethoxyphenylboronic Acid (contains varying amounts of Anhydride). Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
(2,3-dimethoxyphenyl)boronic acid (CAS 40972-86-9) is a chemical compound with the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. IUPAC name: (2,3-dimethoxyphenyl)boronic acid. InChIKey: VREWSCMOGIXMDQ-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4 |
|---|---|
| Molecular weight | 181.98 g/mol |
| IUPAC name | (2,3-dimethoxyphenyl)boronic acid |
| InChIKey | VREWSCMOGIXMDQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3-Dimethoxybenzeneboronic Acid, 2,3-Dimethoxyphenylboronic acid, (2,3-dimethoxyphenyl)boronic Acid, Boronic acid, (2,3-dimethoxyphenyl)-, 2,3-dimethoxyphenyl boronic acid, 2,3-Dimethoxyphenylboronic acid, 97%, 2,3-DimethoxybenzeneboronicAcid, 2,3-dimethoxy-phenylboronic acid, 2,3-dimethoxybenzene boronic acid, (2,3-Dimethoxybenzeneboronic acid