CAS 762263-92-3 appears in our catalog under these names: 2-Hydroxymethyl-4-methoxyphenylboronic acid, 98%, 2-Hydroxymethyl-4-methoxyphenylboronic acid, (2-(Hydroxymethyl)-4-methoxyphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
[2-(hydroxymethyl)-4-methoxyphenyl]boronic acid (CAS 762263-92-3) is a chemical compound with the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. IUPAC name: [2-(hydroxymethyl)-4-methoxyphenyl]boronic acid. InChIKey: WHODEXNNTMLXJQ-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4 |
|---|---|
| Molecular weight | 181.98 g/mol |
| IUPAC name | [2-(hydroxymethyl)-4-methoxyphenyl]boronic acid |
| InChIKey | WHODEXNNTMLXJQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)CO)(O)O |
Computed by PubChem (NCBI)