cas: 103577-61-3 — see every product listed under this CAS number, including other names
2,3-Dimethyl-4-(2,2,2-trifluoroethoxy)pyridine 1-oxide, 98%, 98% (CAS 103577-61-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119XEG-25mg |
| cas | 103577-61-3 |
| size | 25mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 357.20 Pln | |
| Chemat | 100mg | 914.00 Pln | |
| Chemat | 250mg | 1773.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-dimethyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium (CAS 103577-61-3) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 2,3-dimethyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium. InChIKey: GMSURXZOJDDQEF-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 2,3-dimethyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium |
| InChIKey | GMSURXZOJDDQEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)