Products 1341766-01-5
CAS 1341766-01-5 appears in our catalog under these names: 1-Isopropyl-4-(trifluoromethyl)-1h-pyrrole-3-carboxylic acid, 95%, 1-Isopropyl-4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid, 95+%, 1–Isopropyl–4–(trifluoromethyl)–1H–pyrrole–3–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-propan-2-yl-4-(trifluoromethyl)pyrrole-3-carboxylic acid (CAS 1341766-01-5) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 1-propan-2-yl-4-(trifluoromethyl)pyrrole-3-carboxylic acid. InChIKey: VTCMJDWNRUCRSW-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 1-propan-2-yl-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
| InChIKey | VTCMJDWNRUCRSW-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)