CAS 103577-61-3 appears in our catalog under these names: 2,3-Dimethyl-4-(2,2,2-trifluoroethoxy)pyridine 1-oxide, 97+%, Lansoprazole Impurity 21, Lansoprazole Impurity 38, 2,3-Dimethyl-4-(2,2,2-trifluoroethoxy)pyridine 1-Oxide, 2,3-Dimethyl-4-(2,2,2-trifluoroethoxy)pyridine 1-oxide, 98%, 98%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 750mg, 250mg.
2,3-dimethyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium (CAS 103577-61-3) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 2,3-dimethyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium. InChIKey: GMSURXZOJDDQEF-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 2,3-dimethyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium |
| InChIKey | GMSURXZOJDDQEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)