Products 29885-95-8
CAS 29885-95-8 appears in our catalog under these names: N-Methylaniline Trifluoroacetate, >95% (HPLC), N–Methylanilinium Trifluoroacetate, N-Methylanilinium Trifluoroacetate, N-Methylanilinium Trifluoroacetate, >99.0%(T), N-Methylaniline 2,2,2-trifluoroacetate 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 2,5g, 5g, 25g, 100g, 100mg, 250mg, 10g.
Methyl(phenyl)azanium;2,2,2-trifluoroacetate (CAS 29885-95-8) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: methyl(phenyl)azanium;2,2,2-trifluoroacetate. InChIKey: TXXJGCVOHDSYBC-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | methyl(phenyl)azanium;2,2,2-trifluoroacetate |
| InChIKey | TXXJGCVOHDSYBC-UHFFFAOYSA-N |
| SMILES | C[NH2+]C1=CC=CC=C1.C(=O)(C(F)(F)F)[O-] |
Computed by PubChem (NCBI)