cas: 59146-96-2 — see every product listed under this CAS number, including other names
2,3-Dimethyl-6-nitroaniline 98% (CAS 59146-96-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A785873-500g |
| cas | 59146-96-2 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 3212.81 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 854.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A785873 |
2,3-dimethyl-6-nitroaniline (CAS 59146-96-2) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,3-dimethyl-6-nitroaniline. InChIKey: YEFYPFWBLCARLC-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,3-dimethyl-6-nitroaniline |
| InChIKey | YEFYPFWBLCARLC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])N)C |
Computed by PubChem (NCBI)