cas: 59146-96-2 — see every product listed under this CAS number, including other names
2,3-Dimethyl-6-nitroaniline, 98%, 98% (CAS 59146-96-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FK6-1g |
| cas | 59146-96-2 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 100g | 726.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-dimethyl-6-nitroaniline (CAS 59146-96-2) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,3-dimethyl-6-nitroaniline. InChIKey: YEFYPFWBLCARLC-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,3-dimethyl-6-nitroaniline |
| InChIKey | YEFYPFWBLCARLC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])N)C |
Computed by PubChem (NCBI)