cas: 247170-17-8 — see every product listed under this CAS number, including other names
2,4,5-Trifluorocinnamic acid (CAS 247170-17-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007973-1G |
| cas | 247170-17-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 258.26 Pln |
| delivery time | 2-3 weeks |
|---|
(E)-3-(2,4,5-trifluorophenyl)prop-2-enoic acid (CAS 247170-17-8) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: (E)-3-(2,4,5-trifluorophenyl)prop-2-enoic acid. InChIKey: KFVQEUPEGKJFCW-OWOJBTEDSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | (E)-3-(2,4,5-trifluorophenyl)prop-2-enoic acid |
| InChIKey | KFVQEUPEGKJFCW-OWOJBTEDSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)