CAS 1736-56-7 appears in our catalog under these names: 2-Oxo-2-(4-(trifluoromethyl)phenyl)acetaldehyde, 95%, 4-(Trifluoromethyl)phenylglyoxal hydrate, 98%, dry wt. basis, 2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 5g, 1g, 250mg.
2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde (CAS 1736-56-7) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: 2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde. InChIKey: BGOMXTCPIUNFKR-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde |
| InChIKey | BGOMXTCPIUNFKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)C(F)(F)F |
Computed by PubChem (NCBI)