CAS 247170-17-8 appears in our catalog under these names: 2,4,5-Trifluorocinnamic acid, 95%, 2,4,5-Trifluorocinnamic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.
(E)-3-(2,4,5-trifluorophenyl)prop-2-enoic acid (CAS 247170-17-8) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: (E)-3-(2,4,5-trifluorophenyl)prop-2-enoic acid. InChIKey: KFVQEUPEGKJFCW-OWOJBTEDSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | (E)-3-(2,4,5-trifluorophenyl)prop-2-enoic acid |
| InChIKey | KFVQEUPEGKJFCW-OWOJBTEDSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)