CAS 1384157-92-9 appears in our catalog under these names: (E)-3-(2,3,5-Trifluorophenyl)acrylic acid, 97+%, 2,3,5-Trifluorocinnamic acid. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.
(E)-3-(2,3,5-trifluorophenyl)prop-2-enoic acid (CAS 1384157-92-9) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: (E)-3-(2,3,5-trifluorophenyl)prop-2-enoic acid. InChIKey: FHDPERUKPYYNEO-OWOJBTEDSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | (E)-3-(2,3,5-trifluorophenyl)prop-2-enoic acid |
| InChIKey | FHDPERUKPYYNEO-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1/C=C/C(=O)O)F)F)F |
Computed by PubChem (NCBI)