cas: 69807-93-8 — see every product listed under this CAS number, including other names
2,4,6-TRICHLOROPHENYLBORONIC ACID PINACOL ESTER, 98% (CAS 69807-93-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513576-25G |
| cas | 69807-93-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 122.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(2,4,6-trichlorophenyl)-1,3,2-dioxaborolane (CAS 69807-93-8) is a chemical compound with the molecular formula C12H14BCl3O2 and a molecular weight of 307.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,4,6-trichlorophenyl)-1,3,2-dioxaborolane. InChIKey: BGXCPGPJHBGRPJ-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl3O2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,4,6-trichlorophenyl)-1,3,2-dioxaborolane |
| InChIKey | BGXCPGPJHBGRPJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)