cas: 69807-93-8 — see every product listed under this CAS number, including other names
4,4,5,5-tetramethyl-2-(2,4,6-trichlorophenyl)-1,3,2-dioxaborolane, 98%, 98% (CAS 69807-93-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FC3Q-1g |
| cas | 69807-93-8 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 347.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(2,4,6-trichlorophenyl)-1,3,2-dioxaborolane (CAS 69807-93-8) is a chemical compound with the molecular formula C12H14BCl3O2 and a molecular weight of 307.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,4,6-trichlorophenyl)-1,3,2-dioxaborolane. InChIKey: BGXCPGPJHBGRPJ-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl3O2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,4,6-trichlorophenyl)-1,3,2-dioxaborolane |
| InChIKey | BGXCPGPJHBGRPJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)