cas: 908848-70-4 — see every product listed under this CAS number, including other names
2,4-Bis(trifluoromethyl)phenol, 97% (CAS 908848-70-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632292-100MG |
| cas | 908848-70-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 534.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,4-bis(trifluoromethyl)phenol (CAS 908848-70-4) is a chemical compound with the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. IUPAC name: 2,4-bis(trifluoromethyl)phenol. InChIKey: ZYIRCUJWEIIPCK-UHFFFAOYSA-N.
| Molecular formula | C8H4F6O |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2,4-bis(trifluoromethyl)phenol |
| InChIKey | ZYIRCUJWEIIPCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)O |
Computed by PubChem (NCBI)