CAS 54850-27-0 appears in our catalog under these names: 3,4-Bis(trifluoromethyl)phenol, 96%, 3,4-BIs(trifluoromethyl)phenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3,4-bis(trifluoromethyl)phenol (CAS 54850-27-0) is a chemical compound with the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. IUPAC name: 3,4-bis(trifluoromethyl)phenol. InChIKey: BWOZOFYROVHYEH-UHFFFAOYSA-N.
| Molecular formula | C8H4F6O |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 3,4-bis(trifluoromethyl)phenol |
| InChIKey | BWOZOFYROVHYEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)