CAS 46377-35-9 is the registry number for 2,6-Bis(trifluoromethyl)phenol. Offered by: TRC. Available pack sizes: 100mg.
2,6-bis(trifluoromethyl)phenol (CAS 46377-35-9) is a chemical compound with the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)phenol. InChIKey: WMTYURHKRZDHAM-UHFFFAOYSA-N.
| Molecular formula | C8H4F6O |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2,6-bis(trifluoromethyl)phenol |
| InChIKey | WMTYURHKRZDHAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)O)C(F)(F)F |
Computed by PubChem (NCBI)