CAS 779-88-4 appears in our catalog under these names: 2,5-Bis(trifluoromethyl)phenol, 98%, 2,5-Bis(trifluoromethyl)phenol, >95%, >95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g.
2,5-bis(trifluoromethyl)phenol (CAS 779-88-4) is a chemical compound with the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)phenol. InChIKey: OJOPQGWFLQVKDU-UHFFFAOYSA-N.
| Molecular formula | C8H4F6O |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)phenol |
| InChIKey | OJOPQGWFLQVKDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)C(F)(F)F |
Computed by PubChem (NCBI)