cas: 18620-73-0 — see every product listed under this CAS number, including other names
2,4-Diamino-5-nitropyrimidine 97% (CAS 18620-73-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A876095-100mg |
| cas | 18620-73-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 882.12 Pln | |
| Ambeed | 10g | 1560.75 Pln | |
| Ambeed | 25g | 3057.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A876095 |
5-nitropyrimidine-2,4-diamine (CAS 18620-73-0) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 5-nitropyrimidine-2,4-diamine. InChIKey: UUWYIIVPLIJDMQ-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 5-nitropyrimidine-2,4-diamine |
| InChIKey | UUWYIIVPLIJDMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)